cas: 886496-79-3 — see every product listed under this CAS number, including other names
4-Chloro-2-(trifluoromethyl)benzamide 98% (CAS 886496-79-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A585143-1g |
| cas | 886496-79-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 420.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A585143 |
4-chloro-2-(trifluoromethyl)benzamide (CAS 886496-79-3) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)benzamide. InChIKey: MRURROGSGQQKOB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)benzamide |
| InChIKey | MRURROGSGQQKOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)