CAS 40410-54-6 appears in our catalog under these names: N-(3-Chlorophenyl)-2,2,2-trifluoroacetamide, 95%, N-(3-Chlorophenyl)-2,2,2-trifluoroacetamide, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 1g, 5g, 2,5g, 10g, 25g, 50g.
N-(3-chlorophenyl)-2,2,2-trifluoroacetamide (CAS 40410-54-6) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: N-(3-chlorophenyl)-2,2,2-trifluoroacetamide. InChIKey: VRKVCIVKSRGSLU-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | N-(3-chlorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | VRKVCIVKSRGSLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)