CAS 74467-04-2 appears in our catalog under these names: N-Hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride, 95%, N-Hydroxy-2-(trifluoromethyl)benzimidoyl chloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(1Z)-N-hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride (CAS 74467-04-2) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: (1Z)-N-hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride. InChIKey: QKICFEIYQLMRAK-QPEQYQDCSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | (1Z)-N-hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride |
| InChIKey | QKICFEIYQLMRAK-QPEQYQDCSA-N |
| SMILES | C1=CC=C(C(=C1)/C(=N/O)/Cl)C(F)(F)F |
Computed by PubChem (NCBI)