cas: 53903-51-8 — see every product listed under this CAS number, including other names
4-Chloro-2-(trifluoromethyl)phenol 95% (CAS 53903-51-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115357-100mg |
| cas | 53903-51-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 587.31 Pln | |
| Ambeed | 10g | 1099.06 Pln | |
| Ambeed | 25g | 2645.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A115357 |
4-chloro-2-(trifluoromethyl)phenol (CAS 53903-51-8) is a chemical compound with the molecular formula C7H4ClF3O and a molecular weight of 196.55 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)phenol. InChIKey: LUYVFIYUQPJQOJ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O |
|---|---|
| Molecular weight | 196.55 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)phenol |
| InChIKey | LUYVFIYUQPJQOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)O |
Computed by PubChem (NCBI)