cas: 22459-72-9 — see every product listed under this CAS number, including other names
4-Chloro-2-methoxy-5-nitroaniline, 98%, 98% (CAS 22459-72-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12WT96-5g |
| cas | 22459-72-9 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1682.00 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-methoxy-5-nitroaniline (CAS 22459-72-9) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 4-chloro-2-methoxy-5-nitroaniline. InChIKey: VJLQAJYDEDLSGO-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 4-chloro-2-methoxy-5-nitroaniline |
| InChIKey | VJLQAJYDEDLSGO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)