cas: 916344-45-1 — see every product listed under this CAS number, including other names
4-Chloro-3,5-diethoxybenzaldehyde, 95%, 95% (CAS 916344-45-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3JF-100mg |
| cas | 916344-45-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-chloro-3,5-diethoxybenzaldehyde (CAS 916344-45-1) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: 4-chloro-3,5-diethoxybenzaldehyde. InChIKey: CVGUZCQQVNVWQO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 4-chloro-3,5-diethoxybenzaldehyde |
| InChIKey | CVGUZCQQVNVWQO-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1Cl)OCC)C=O |
Computed by PubChem (NCBI)