cas: 59210-68-3 — see every product listed under this CAS number, including other names
4-Chloro-3-(N,N-diethylsulfamoyl)benzoic acid, 97% (CAS 59210-68-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A689177-5g |
| cas | 59210-68-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6417.25 Pln | |
| AmBeed | 10g | 10225.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-chloro-3-(diethylsulfamoyl)benzoic acid (CAS 59210-68-3) is a chemical compound with the molecular formula C11H14ClNO4S and a molecular weight of 291.75 g/mol. IUPAC name: 4-chloro-3-(diethylsulfamoyl)benzoic acid. InChIKey: OANXBFKRXPGEGI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4S |
|---|---|
| Molecular weight | 291.75 g/mol |
| IUPAC name | 4-chloro-3-(diethylsulfamoyl)benzoic acid |
| InChIKey | OANXBFKRXPGEGI-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)