Products 1218722-33-8

CAS 1218722-33-8 is the registry number for 2-[(4-Chlorophenyl)(methylsulfonyl)amino]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-chloro-N-methylsulfonylanilino)butanoic acid (CAS 1218722-33-8) is a chemical compound with the molecular formula C11H14ClNO4S and a molecular weight of 291.75 g/mol. IUPAC name: 2-(4-chloro-N-methylsulfonylanilino)butanoic acid. InChIKey: VLACUDABPCZYEB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO4S
Molecular weight291.75 g/mol
IUPAC name2-(4-chloro-N-methylsulfonylanilino)butanoic acid
InChIKeyVLACUDABPCZYEB-UHFFFAOYSA-N
SMILESCCC(C(=O)O)N(C1=CC=C(C=C1)Cl)S(=O)(=O)C

Computed by PubChem (NCBI)