CAS 1009549-57-8 appears in our catalog under these names: 2-([(3-Chlorophenyl)sulfonyl]amino)-3-methylbutanoic acid, 95%, 2–(3–chlorobenzenesulfonamido)–3–methylbutanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoic acid (CAS 1009549-57-8) is a chemical compound with the molecular formula C11H14ClNO4S and a molecular weight of 291.75 g/mol. IUPAC name: 2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoic acid. InChIKey: JABGGVIJYNCUIL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4S |
|---|---|
| Molecular weight | 291.75 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoic acid |
| InChIKey | JABGGVIJYNCUIL-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NS(=O)(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)