cas: 879088-41-2 — see every product listed under this CAS number, including other names
4-Chloro-3-(pyridin-2-yl)aniline, 98% (CAS 879088-41-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F331212-100MG |
| cas | 879088-41-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1887.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-3-pyridin-2-ylaniline (CAS 879088-41-2) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 4-chloro-3-pyridin-2-ylaniline. InChIKey: QWVLHTCIAZPQAY-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 4-chloro-3-pyridin-2-ylaniline |
| InChIKey | QWVLHTCIAZPQAY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=C(C=CC(=C2)N)Cl |
Computed by PubChem (NCBI)