CAS 886507-57-9 appears in our catalog under these names: 2-(4-Chlorophenyl)pyridin-3-amine, 95%, 2-(4-Chloro-phenyl)-pyridin-3-ylamine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
2-(4-chlorophenyl)pyridin-3-amine (CAS 886507-57-9) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 2-(4-chlorophenyl)pyridin-3-amine. InChIKey: CYQQPRJCVMRFPQ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 2-(4-chlorophenyl)pyridin-3-amine |
| InChIKey | CYQQPRJCVMRFPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)