CAS 2438139-88-7 is the registry number for 5-Chloro-2-cyclopropyl-1,8-naphthyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-cyclopropyl-1,8-naphthyridine (CAS 2438139-88-7) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 5-chloro-2-cyclopropyl-1,8-naphthyridine. InChIKey: WNNAUPHGFUAZTA-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 5-chloro-2-cyclopropyl-1,8-naphthyridine |
| InChIKey | WNNAUPHGFUAZTA-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=NC=CC(=C3C=C2)Cl |
Computed by PubChem (NCBI)