cas: 886500-85-2 — see every product listed under this CAS number, including other names
4-Chloro-3-(trifluoromethoxy)phenol 98% (CAS 886500-85-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175308-10g |
| cas | 886500-85-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2000.19 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175308 |
4-chloro-3-(trifluoromethoxy)phenol (CAS 886500-85-2) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 4-chloro-3-(trifluoromethoxy)phenol. InChIKey: ZLZLXAOLRWLDID-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethoxy)phenol |
| InChIKey | ZLZLXAOLRWLDID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)