cas: 56447-54-2 — see every product listed under this CAS number, including other names
4-Chloro-5-(chlorosulfonyl)-2-fluorobenzoic acid 95% (CAS 56447-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A710991-1g |
| cas | 56447-54-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 398.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A710991 |
4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid (CAS 56447-54-2) is a chemical compound with the molecular formula C7H3Cl2FO4S and a molecular weight of 273.06 g/mol. IUPAC name: 4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid. InChIKey: YMIBTQKARVYVLX-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO4S |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid |
| InChIKey | YMIBTQKARVYVLX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)