CAS 264927-50-6 is the registry number for 2-Chloro-5-chlorosulfonyl-4-fluorobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
2-chloro-5-chlorosulfonyl-4-fluorobenzoic acid (CAS 264927-50-6) is a chemical compound with the molecular formula C7H3Cl2FO4S and a molecular weight of 273.06 g/mol. IUPAC name: 2-chloro-5-chlorosulfonyl-4-fluorobenzoic acid. InChIKey: QOPIIRYHSQOQRN-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO4S |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 2-chloro-5-chlorosulfonyl-4-fluorobenzoic acid |
| InChIKey | QOPIIRYHSQOQRN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)F)Cl)C(=O)O |
Computed by PubChem (NCBI)