cas: 56447-54-2 — see every product listed under this CAS number, including other names
4-Chloro-5-(chlorosulfonyl)-2-fluorobenzoic acid, 95% (CAS 56447-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043750-1G |
| cas | 56447-54-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 388.42 Pln | |
| Fluorochem | 100g | 1377.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid (CAS 56447-54-2) is a chemical compound with the molecular formula C7H3Cl2FO4S and a molecular weight of 273.06 g/mol. IUPAC name: 4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid. InChIKey: YMIBTQKARVYVLX-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO4S |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid |
| InChIKey | YMIBTQKARVYVLX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)