4-Chloro-5-(chlorosulfonyl)-2-fluorobenzoic acid, 95%
cas: 56447-54-2 — see every product listed under this CAS number, including other names
4-Chloro-5-(chlorosulfonyl)-2-fluorobenzoic acid, 95% (CAS 56447-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F043750-1G |
| cas | 56447-54-2 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 404.04 Pln | |
| Fluorochem | 100g | 1445.34 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 426.00 Pln | |
| Ambeed | 25g | 948.88 Pln | |
| BLDpharm | 25g | 536.50 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid (CAS 56447-54-2) is a chemical compound with the molecular formula C7H3Cl2FO4S and a molecular weight of 273.06 g/mol. IUPAC name: 4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid. InChIKey: YMIBTQKARVYVLX-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO4S |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 4-chloro-5-chlorosulfonyl-2-fluorobenzoic acid |
| InChIKey | YMIBTQKARVYVLX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)