CAS 67073-39-6 appears in our catalog under these names: 4–Chloro–5–nitrobenzene–1,2–diamine, 4-Chloro-5-nitro-o-phenylenediamine, 98%, 4-Chloro-5-nitrobenzene-1,2-diamine, 4-Chloro-5-nitrobenzene-1,2-diamine, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 2,5g, 100mg.
4-chloro-5-nitrobenzene-1,2-diamine (CAS 67073-39-6) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: 4-chloro-5-nitrobenzene-1,2-diamine. InChIKey: LOQLMWFVXRZASN-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 4-chloro-5-nitrobenzene-1,2-diamine |
| InChIKey | LOQLMWFVXRZASN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Cl)N)N |
Computed by PubChem (NCBI)