CAS 261764-92-5 appears in our catalog under these names: 2-Chloro-4-nitrobenzene-1,3-diamine, 95%, Aclonifen Impurity 1. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
2-chloro-4-nitrobenzene-1,3-diamine (CAS 261764-92-5) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: 2-chloro-4-nitrobenzene-1,3-diamine. InChIKey: NTLGTOMYCVBTHT-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-chloro-4-nitrobenzene-1,3-diamine |
| InChIKey | NTLGTOMYCVBTHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)Cl)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)