CAS 26196-45-2 appears in our catalog under these names: 2–Chloro–5–nitro–1,4–phenylenediamine, 2-Chloro-5-nitrobenzene-1,4-diamine, 2-Chloro-5-nitro-1,4-phenylenediamine, 97%, 2-Chloro-5-nitrobenzene-1,4-diamine, 98%, 2-Chloro-5-nitro-1,4-benzenediamine, 95%,RG. Offered by: GLPBio, Chemat, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 1g.
2-chloro-5-nitrobenzene-1,4-diamine (CAS 26196-45-2) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: 2-chloro-5-nitrobenzene-1,4-diamine. InChIKey: VUNAQOGRLGNALG-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-chloro-5-nitrobenzene-1,4-diamine |
| InChIKey | VUNAQOGRLGNALG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])N)Cl)N |
Computed by PubChem (NCBI)