cas: 103862-63-1 — see every product listed under this CAS number, including other names
4-Chloro-6-ethoxyquinoline 98% (CAS 103862-63-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A387825-1g |
| cas | 103862-63-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1193.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A387825 |
4-chloro-6-ethoxyquinoline (CAS 103862-63-1) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 4-chloro-6-ethoxyquinoline. InChIKey: UMAFNRLXFGANJH-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 4-chloro-6-ethoxyquinoline |
| InChIKey | UMAFNRLXFGANJH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=CN=C2C=C1)Cl |
Computed by PubChem (NCBI)