4-Chloro-6-fluorocinnoline, 97%
cas: 2251-62-9 — see every product listed under this CAS number, including other names
4-Chloro-6-fluorocinnoline, 97% (CAS 2251-62-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A264042-250mg |
| cas | 2251-62-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 693.00 Pln | |
| Ambeed | 1g | 1749.88 Pln | |
| BLDpharm | 100mg | 469.86 Pln | |
| BLDpharm | 250mg | 741.99 Pln | |
| BLDpharm | 1g | 1880.47 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1336.40 Pln | |
| Fluorochem | 5g | 7208.94 Pln | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1794.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-6-fluorocinnoline (CAS 2251-62-9) is a chemical compound with the molecular formula C8H4ClFN2 and a molecular weight of 182.58 g/mol. IUPAC name: 4-chloro-6-fluorocinnoline. InChIKey: VFOBRNBIAYZTNM-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2 |
|---|---|
| Molecular weight | 182.58 g/mol |
| IUPAC name | 4-chloro-6-fluorocinnoline |
| InChIKey | VFOBRNBIAYZTNM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN=N2)Cl |
Computed by PubChem (NCBI)