CAS 1378470-92-8 appears in our catalog under these names: 2-Chloro-7-fluoro-1,5-naphthyridine, 95%, 2-Chloro-7-fluoro-1,5-naphthyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-chloro-7-fluoro-1,5-naphthyridine (CAS 1378470-92-8) is a chemical compound with the molecular formula C8H4ClFN2 and a molecular weight of 182.58 g/mol. IUPAC name: 2-chloro-7-fluoro-1,5-naphthyridine. InChIKey: LCPAJDYXZGMQJZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2 |
|---|---|
| Molecular weight | 182.58 g/mol |
| IUPAC name | 2-chloro-7-fluoro-1,5-naphthyridine |
| InChIKey | LCPAJDYXZGMQJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=CC(=C2)F)Cl |
Computed by PubChem (NCBI)