CAS 2089054-23-7 appears in our catalog under these names: 2-chloro-6-fluoro-1,7-naphthyridine, 97%, 2-chloro-6-fluoro-1,7-naphthyridine, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
2-chloro-6-fluoro-1,7-naphthyridine (CAS 2089054-23-7) is a chemical compound with the molecular formula C8H4ClFN2 and a molecular weight of 182.58 g/mol. IUPAC name: 2-chloro-6-fluoro-1,7-naphthyridine. InChIKey: IVBBUUWDRRWWTN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2 |
|---|---|
| Molecular weight | 182.58 g/mol |
| IUPAC name | 2-chloro-6-fluoro-1,7-naphthyridine |
| InChIKey | IVBBUUWDRRWWTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=CN=C(C=C21)F)Cl |
Computed by PubChem (NCBI)