4-Chloro-6-methoxy-5-nitropyrimidine, 95%
cas: 52854-14-5 — see every product listed under this CAS number, including other names
4-Chloro-6-methoxy-5-nitropyrimidine, 95% (CAS 52854-14-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QV-2024-1g |
| cas | 52854-14-5 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 773.70 Pln | |
| Fluorochem | 10g | 1486.99 Pln | |
| Fluorochem | 25g | 2559.53 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2550.88 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 539.60 Pln | |
| Chemat | 10g | 918.80 Pln | |
| Chemat | 25g | 1926.80 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 836.40 Pln | |
| BLDpharm | 25g | 2746.84 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-chloro-6-methoxy-5-nitropyrimidine (CAS 52854-14-5) is a chemical compound with the molecular formula C5H4ClN3O3 and a molecular weight of 189.56 g/mol. IUPAC name: 4-chloro-6-methoxy-5-nitropyrimidine. InChIKey: YZTJXHWQWCLEJX-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O3 |
|---|---|
| Molecular weight | 189.56 g/mol |
| IUPAC name | 4-chloro-6-methoxy-5-nitropyrimidine |
| InChIKey | YZTJXHWQWCLEJX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)