cas: 325685-59-4 — see every product listed under this CAS number, including other names
4-Chloro-6-methoxymethyl-2-phenylpyrimidine, 98% (CAS 325685-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607873-100MG |
| cas | 325685-59-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 2965.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-6-(methoxymethyl)-2-phenylpyrimidine (CAS 325685-59-4) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 4-chloro-6-(methoxymethyl)-2-phenylpyrimidine. InChIKey: GSSSCZAOXFZADM-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 4-chloro-6-(methoxymethyl)-2-phenylpyrimidine |
| InChIKey | GSSSCZAOXFZADM-UHFFFAOYSA-N |
| SMILES | COCC1=CC(=NC(=N1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)