cas: 941685-26-3 — see every product listed under this CAS number, including other names
4-Chloro-7-((2-(trimethylsilyl)ethoxy)methyl)-7H-pyrrolo[2,3-d]pyrimidine, 98% (CAS 941685-26-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319918-1G |
| cas | 941685-26-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 450.90 Pln | |
| Fluorochem | 100g | 1424.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane (CAS 941685-26-3) is a chemical compound with the molecular formula C12H18ClN3OSi and a molecular weight of 283.83 g/mol. IUPAC name: 2-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane. InChIKey: YWBDBLXIRAQZIH-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3OSi |
|---|---|
| Molecular weight | 283.83 g/mol |
| IUPAC name | 2-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | YWBDBLXIRAQZIH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C=CC2=C1N=CN=C2Cl |
Computed by PubChem (NCBI)