Products 1270497-66-9
CAS 1270497-66-9 is the registry number for 3-Chloro-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo[2,3-b]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-chloropyrrolo[2,3-b]pyrazin-5-yl)methoxy]ethyl-trimethylsilane (CAS 1270497-66-9) is a chemical compound with the molecular formula C12H18ClN3OSi and a molecular weight of 283.83 g/mol. IUPAC name: 2-[(3-chloropyrrolo[2,3-b]pyrazin-5-yl)methoxy]ethyl-trimethylsilane. InChIKey: WCRNBHMOCCZLAD-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3OSi |
|---|---|
| Molecular weight | 283.83 g/mol |
| IUPAC name | 2-[(3-chloropyrrolo[2,3-b]pyrazin-5-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | WCRNBHMOCCZLAD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C=CC2=NC=C(N=C21)Cl |
Computed by PubChem (NCBI)