CAS 2758808-40-9 is the registry number for 2-Chloro-3-((2-(trimethylsilyl)ethoxy)methyl)-3H-imidazo[4,5-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-chloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane (CAS 2758808-40-9) is a chemical compound with the molecular formula C12H18ClN3OSi and a molecular weight of 283.83 g/mol. IUPAC name: 2-[(2-chloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane. InChIKey: MMQVJIPDABGKLN-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3OSi |
|---|---|
| Molecular weight | 283.83 g/mol |
| IUPAC name | 2-[(2-chloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | MMQVJIPDABGKLN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C2=C(C=CC=N2)N=C1Cl |
Computed by PubChem (NCBI)