cas: 2447-87-2 — see every product listed under this CAS number, including other names
4-Chloro-N,N-di-n-propylbenzamide (CAS 2447-87-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113O9Q-50mg |
| cas | 2447-87-2 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 347.60 Pln | |
| Chemat | 250mg | 1346.00 Pln | |
| Chemat | 1g | 4542.80 Pln |
| delivery time | 3 weeks |
|---|
4-chloro-N,N-dipropylbenzamide (CAS 2447-87-2) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 4-chloro-N,N-dipropylbenzamide. InChIKey: XKGIVKGUUFHCHB-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 4-chloro-N,N-dipropylbenzamide |
| InChIKey | XKGIVKGUUFHCHB-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)