cas: 2447-87-2 — see every product listed under this CAS number, including other names
NSC 6038 (CAS 2447-87-2) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T4632-2mg |
| cas | 2447-87-2 |
| size | 2mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 399.00 Pln | |
| TargetMol | 5mg | 499.07 Pln | |
| TargetMol | 10mg | 665.09 Pln | |
| TargetMol | 25mg | 997.13 Pln | |
| TargetMol | 50mg | 1395.14 Pln | |
| TargetMol | 100mg | 1993.27 Pln | |
| TargetMol | 200mg | 2829.54 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
4-chloro-N,N-dipropylbenzamide (CAS 2447-87-2) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 4-chloro-N,N-dipropylbenzamide. InChIKey: XKGIVKGUUFHCHB-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 4-chloro-N,N-dipropylbenzamide |
| InChIKey | XKGIVKGUUFHCHB-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)