cas: 223919-54-8 — see every product listed under this CAS number, including other names
4-Chloro-trans-beta-styrylboronic acid pinacol ester, 98% (CAS 223919-54-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230883-250MG |
| cas | 223919-54-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 10g | 2257.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[(E)-2-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 223919-54-8) is a chemical compound with the molecular formula C14H18BClO2 and a molecular weight of 264.56 g/mol. IUPAC name: 2-[(E)-2-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CQJXSSVRGHRVOK-MDZDMXLPSA-N.
| Molecular formula | C14H18BClO2 |
|---|---|
| Molecular weight | 264.56 g/mol |
| IUPAC name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CQJXSSVRGHRVOK-MDZDMXLPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)