cas: 1256358-95-8 — see every product listed under this CAS number, including other names
4-Chloroindole-2-boronic acid, pinacol ester, 98%, 98% (CAS 1256358-95-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110K63-250mg |
| cas | 1256358-95-8 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1256358-95-8) is a chemical compound with the molecular formula C14H17BClNO2 and a molecular weight of 277.55 g/mol. IUPAC name: 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: SJXBYHLXCIZBPR-UHFFFAOYSA-N.
| Molecular formula | C14H17BClNO2 |
|---|---|
| Molecular weight | 277.55 g/mol |
| IUPAC name | 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | SJXBYHLXCIZBPR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=CC=C3Cl |
Computed by PubChem (NCBI)