CAS 1256358-95-8 appears in our catalog under these names: 4-Chloroindole-2-boronic acid, pinacol ester, 95%, 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 98%, 4-Chloroindole-2-boronic acid, pinacol ester, 98%, 98%, 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1256358-95-8) is a chemical compound with the molecular formula C14H17BClNO2 and a molecular weight of 277.55 g/mol. IUPAC name: 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: SJXBYHLXCIZBPR-UHFFFAOYSA-N.
| Molecular formula | C14H17BClNO2 |
|---|---|
| Molecular weight | 277.55 g/mol |
| IUPAC name | 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | SJXBYHLXCIZBPR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=CC=C3Cl |
Computed by PubChem (NCBI)