Products 912331-84-1

CAS 912331-84-1 is the registry number for 6-Chloroindole-2-boronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

6-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 912331-84-1) is a chemical compound with the molecular formula C14H17BClNO2 and a molecular weight of 277.55 g/mol. IUPAC name: 6-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: WYCUFMHCRJWJRE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17BClNO2
Molecular weight277.55 g/mol
IUPAC name6-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
InChIKeyWYCUFMHCRJWJRE-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=C(C=C3)Cl

Computed by PubChem (NCBI)