cas: 604-44-4 — see every product listed under this CAS number, including other names
4-Chloronaphthalen-1-ol, 98%, 98% (CAS 604-44-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9WW-1g |
| cas | 604-44-4 |
| size | 1g |
| availability | 94.999g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 280.40 Pln | |
| Chemat | 25g | 549.20 Pln | |
| Chemat | 50g | 990.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloronaphthalen-1-ol (CAS 604-44-4) is a chemical compound with the molecular formula C10H7ClO and a molecular weight of 178.61 g/mol. IUPAC name: 4-chloronaphthalen-1-ol. InChIKey: LVSPDZAGCBEQAV-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO |
|---|---|
| Molecular weight | 178.61 g/mol |
| IUPAC name | 4-chloronaphthalen-1-ol |
| InChIKey | LVSPDZAGCBEQAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)O |
Computed by PubChem (NCBI)