CAS 116668-72-5 appears in our catalog under these names: 1-Chloro-6-hydroxynaphthalene, 95%, 1–Chloro–6–naphthol, 1-Chloro-6-naphthol 95%, 1-Chloro-6-naphthol, 98%, 98%, 1-Chloro-6-naphthol, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
5-chloronaphthalen-2-ol (CAS 116668-72-5) is a chemical compound with the molecular formula C10H7ClO and a molecular weight of 178.61 g/mol. IUPAC name: 5-chloronaphthalen-2-ol. InChIKey: ZWSXQPLATWDSME-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO |
|---|---|
| Molecular weight | 178.61 g/mol |
| IUPAC name | 5-chloronaphthalen-2-ol |
| InChIKey | ZWSXQPLATWDSME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C(=C1)Cl |
Computed by PubChem (NCBI)