CAS 56820-70-3 appears in our catalog under these names: 2-Chloro-5-hydroxynaphthalene, 95%, 6-Chloronaphthalen-1-ol 95%, 6-Chloronaphthalen-1-ol, 95%, 95%, 6-CHLORONAPHTHALEN-1-OL, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-chloronaphthalen-1-ol (CAS 56820-70-3) is a chemical compound with the molecular formula C10H7ClO and a molecular weight of 178.61 g/mol. IUPAC name: 6-chloronaphthalen-1-ol. InChIKey: NRLZGPVINJTXJL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO |
|---|---|
| Molecular weight | 178.61 g/mol |
| IUPAC name | 6-chloronaphthalen-1-ol |
| InChIKey | NRLZGPVINJTXJL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)C(=C1)O |
Computed by PubChem (NCBI)