CAS 104615-78-3 appears in our catalog under these names: 4-Chloro-2-cyanophenylisothiocyanate, 97%, 4-Chloro-2-cyanophenylisothiocyanate, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
5-chloro-2-isothiocyanatobenzonitrile (CAS 104615-78-3) is a chemical compound with the molecular formula C8H3ClN2S and a molecular weight of 194.64 g/mol. IUPAC name: 5-chloro-2-isothiocyanatobenzonitrile. InChIKey: XJVKXLHNCRNMAV-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 5-chloro-2-isothiocyanatobenzonitrile |
| InChIKey | XJVKXLHNCRNMAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C#N)N=C=S |
Computed by PubChem (NCBI)