4-Cyano-3-fluorophenyl 4-pentylbenzoate, 98%
cas: 86786-89-2 — see every product listed under this CAS number, including other names
4-Cyano-3-fluorophenyl 4-pentylbenzoate, 98% (CAS 86786-89-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A736086-1g |
| cas | 86786-89-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 470.50 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 325.47 Pln | |
| BLDpharm | 25g | 503.18 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 279.09 Pln | |
| Fluorochem | 25g | 482.14 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(4-cyano-3-fluorophenyl) 4-pentylbenzoate (CAS 86786-89-2) is a chemical compound with the molecular formula C19H18FNO2 and a molecular weight of 311.3 g/mol. IUPAC name: (4-cyano-3-fluorophenyl) 4-pentylbenzoate. InChIKey: ISGYBTOINXAQJG-UHFFFAOYSA-N.
| Molecular formula | C19H18FNO2 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (4-cyano-3-fluorophenyl) 4-pentylbenzoate |
| InChIKey | ISGYBTOINXAQJG-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C(=O)OC2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)