CAS 2377679-85-9 is the registry number for TLR2/9 antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-fluoro-2-hydroxy-5-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]benzaldehyde (CAS 2377679-85-9) is a chemical compound with the molecular formula C19H18FNO2 and a molecular weight of 311.3 g/mol. IUPAC name: 3-fluoro-2-hydroxy-5-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]benzaldehyde. InChIKey: GDSIRENPKAXCKA-ONEGZZNKSA-N.
| Molecular formula | C19H18FNO2 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 3-fluoro-2-hydroxy-5-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]benzaldehyde |
| InChIKey | GDSIRENPKAXCKA-ONEGZZNKSA-N |
| SMILES | C1CCN(C1)C2=CC=C(C=C2)/C=C/C3=CC(=C(C(=C3)F)O)C=O |
Computed by PubChem (NCBI)