CAS 714278-29-2 is the registry number for 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl 3-fluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,2,4-trimethyl-1H-quinolin-6-yl) 3-fluorobenzoate (CAS 714278-29-2) is a chemical compound with the molecular formula C19H18FNO2 and a molecular weight of 311.3 g/mol. IUPAC name: (2,2,4-trimethyl-1H-quinolin-6-yl) 3-fluorobenzoate. InChIKey: HQPJEZKOVWECFG-UHFFFAOYSA-N.
| Molecular formula | C19H18FNO2 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (2,2,4-trimethyl-1H-quinolin-6-yl) 3-fluorobenzoate |
| InChIKey | HQPJEZKOVWECFG-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)OC(=O)C3=CC(=CC=C3)F)(C)C |
Computed by PubChem (NCBI)