cas: 27634-89-5 — see every product listed under this CAS number, including other names
4-Cyclohexyl-benzaldehyde, 95% (CAS 27634-89-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633389-100MG |
| cas | 27634-89-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 409.25 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 500mg | 1502.61 Pln | |
| Fluorochem | 1g | 1965.99 Pln | |
| Fluorochem | 5g | 5636.57 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-cyclohexylbenzaldehyde (CAS 27634-89-5) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 4-cyclohexylbenzaldehyde. InChIKey: KUHNCPCUPOPMDY-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 4-cyclohexylbenzaldehyde |
| InChIKey | KUHNCPCUPOPMDY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)