4-Cyclopentylbenzene-1,3-diol, 95%
cas: 21713-03-1 — see every product listed under this CAS number, including other names
4-Cyclopentylbenzene-1,3-diol, 95% (CAS 21713-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A554592-100mg |
| cas | 21713-03-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1730.53 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-cyclopentylbenzene-1,3-diol (CAS 21713-03-1) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 4-cyclopentylbenzene-1,3-diol. InChIKey: IXMNGROEFGBSGO-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-cyclopentylbenzene-1,3-diol |
| InChIKey | IXMNGROEFGBSGO-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=C(C=C(C=C2)O)O |
Computed by PubChem (NCBI)