4-Ethynyl-4'-propyl-1,1'-biphenyl, 95%
cas: 360768-57-6 — see every product listed under this CAS number, including other names
4-Ethynyl-4'-propyl-1,1'-biphenyl, 95% (CAS 360768-57-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A192031-1g |
| cas | 360768-57-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 387.06 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 292.14 Pln | |
| BLDpharm | 25g | 353.23 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-ethynyl-4-(4-propylphenyl)benzene (CAS 360768-57-6) is a chemical compound with the molecular formula C17H16 and a molecular weight of 220.31 g/mol. IUPAC name: 1-ethynyl-4-(4-propylphenyl)benzene. InChIKey: ZBSZCHDBZRCUES-UHFFFAOYSA-N.
| Molecular formula | C17H16 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 1-ethynyl-4-(4-propylphenyl)benzene |
| InChIKey | ZBSZCHDBZRCUES-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)