CAS 29778-31-2 is the registry number for 1-(2-(2,4,6-Trimethylphenyl)ethynyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1,3,5-trimethyl-2-(2-phenylethynyl)benzene (CAS 29778-31-2) is a chemical compound with the molecular formula C17H16 and a molecular weight of 220.31 g/mol. IUPAC name: 1,3,5-trimethyl-2-(2-phenylethynyl)benzene. InChIKey: PRNZPCQJFVBCJG-UHFFFAOYSA-N.
| Molecular formula | C17H16 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-(2-phenylethynyl)benzene |
| InChIKey | PRNZPCQJFVBCJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C#CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)