CAS 30436-55-6 is the registry number for 1,2,6-Trimethyl-phenanthrene, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1,2,6-trimethylphenanthrene (CAS 30436-55-6) is a chemical compound with the molecular formula C17H16 and a molecular weight of 220.31 g/mol. IUPAC name: 1,2,6-trimethylphenanthrene. InChIKey: MYWOJODOMFBVCB-UHFFFAOYSA-N.
| Molecular formula | C17H16 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 1,2,6-trimethylphenanthrene |
| InChIKey | MYWOJODOMFBVCB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC3=C2C=CC(=C3C)C |
Computed by PubChem (NCBI)