4-Fluoro-1-nitro-2-vinylbenzene, 95% mix TBC as stabilizer
cas: 951667-82-6 — see every product listed under this CAS number, including other names
4-Fluoro-1-nitro-2-vinylbenzene, 95% mix TBC as stabilizer (CAS 951667-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A833402-100mg |
| cas | 951667-82-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2155.94 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2319.21 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 2224.40 Pln |
properties
| purity | 95% mix TBC as stabilizer |
|---|---|
| delivery time | 2-3 weeks |
2-ethenyl-4-fluoro-1-nitrobenzene (CAS 951667-82-6) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: 2-ethenyl-4-fluoro-1-nitrobenzene. InChIKey: RKFMDUVMPSAXRJ-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 2-ethenyl-4-fluoro-1-nitrobenzene |
| InChIKey | RKFMDUVMPSAXRJ-UHFFFAOYSA-N |
| SMILES | C=CC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)