cas: 1256359-96-2 — see every product listed under this CAS number, including other names
4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 95% (CAS 1256359-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160359-100mg |
| cas | 1256359-96-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 782.00 Pln | |
| Ambeed | 1g | 1488.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A160359 |
4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1256359-96-2) is a chemical compound with the molecular formula C14H17BFNO2 and a molecular weight of 261.10 g/mol. IUPAC name: 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: KQBFUSLFUVLNQM-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | KQBFUSLFUVLNQM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=CC=C3F |
Computed by PubChem (NCBI)