CAS 2377610-43-8 appears in our catalog under these names: 2-Cyanomethyl-4-fluorophenylboronic acid, pinacol ester, 97%, 2-Cyanomethyl-4-fluorophenylboronic acid, pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
2-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (CAS 2377610-43-8) is a chemical compound with the molecular formula C14H17BFNO2 and a molecular weight of 261.10 g/mol. IUPAC name: 2-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile. InChIKey: QJVAPMKKMMNMKN-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 2-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| InChIKey | QJVAPMKKMMNMKN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)CC#N |
Computed by PubChem (NCBI)