CAS 1256359-96-2 appears in our catalog under these names: 4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 95%, 4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%, 4-Fluoroindole-2-boronic acid pinacol ester, 95%, 4-fluoroindole-2-boronic acid pinacol ester, 95%, 95%. Offered by: Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1256359-96-2) is a chemical compound with the molecular formula C14H17BFNO2 and a molecular weight of 261.10 g/mol. IUPAC name: 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: KQBFUSLFUVLNQM-UHFFFAOYSA-N.
| Molecular formula | C14H17BFNO2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | KQBFUSLFUVLNQM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=CC=C3F |
Computed by PubChem (NCBI)